C15H24F10N2 — CID 89292987
N',N'-dimethyl-N-[7,8,8,8-tetrafluoro-5,7-bis(trifluoromethyl)octyl]propane-1,3-diamine (PubChem CID 89292987) has the molecular formula C15H24F10N2 and a molecular weight of 422.35 g/mol. Its IUPAC name is N',N'-dimethyl-N-[7,8,8,8-tetrafluoro-5,7-bis(trifluoromethyl)octyl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[7,8,8,8-tetrafluoro-5,7-bis(trifluoromethyl)octyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 89292987 |
| Molecular Formula | C15H24F10N2 |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N',N'-dimethyl-N-[7,8,8,8-tetrafluoro-5,7-bis(trifluoromethyl)octyl]propane-1,3-diamine |
| SMILES | CN(C)CCCNCCCCC(CC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H24F10N2/c1-27(2)9-5-8-26-7-4-3-6-11(13(17,18)19)10-12(16,14(20,21)22)15(23,24)25/h11,26H,3-10H2,1-2H3 |
| InChIKey | YCADKTKXNAHHLV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|