C17H30N2O4 — CID 89293044
methyl (2S)-2-[[(3S,4S)-3-acetamido-3,4-dimethylhexyl]-formylamino]pent-4-enoate (PubChem CID 89293044) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is methyl (2S)-2-[[(3S,4S)-3-acetamido-3,4-dimethylhexyl]-formylamino]pent-4-enoate.
| Compound Name | methyl (2S)-2-[[(3S,4S)-3-acetamido-3,4-dimethylhexyl]-formylamino]pent-4-enoate |
|---|---|
| PubChem CID | 89293044 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | methyl (2S)-2-[[(3S,4S)-3-acetamido-3,4-dimethylhexyl]-formylamino]pent-4-enoate |
| SMILES | C=CC[C@@H](C(=O)OC)N(C=O)CC[C@](C)(NC(C)=O)[C@@H](C)CC |
| InChI | InChI=1S/C17H30N2O4/c1-7-9-15(16(22)23-6)19(12-20)11-10-17(5,13(3)8-2)18-14(4)21/h7,12-13,15H,1,8-11H2,2-6H3,(H,18,21)/t13-,15-,17-/m0/s1 |
| InChIKey | PATWLPGTEDMYOL-QRTARXTBSA-N |
| XLogP | 1.89 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|