C24H36O4 — CID 89293070
4-[[(1R,4aR,8R,8aS)-8-ethenyl-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methoxy]-4-oxobutanoic acid (PubChem CID 89293070) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is 4-[[(1R,4aR,8R,8aS)-8-ethenyl-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methoxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(1R,4aR,8R,8aS)-8-ethenyl-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 89293070 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 4-[[(1R,4aR,8R,8aS)-8-ethenyl-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methoxy]-4-oxobutanoic acid |
| SMILES | C=C[C@@]1(C)CCC=C2[C@H]1CCC1[C@](C)(COC(=O)CCC(=O)O)CCC[C@@]21C |
| InChI | InChI=1S/C24H36O4/c1-5-22(2)13-6-8-18-17(22)9-10-19-23(3,14-7-15-24(18,19)4)16-28-21(27)12-11-20(25)26/h5,8,17,19H,1,6-7,9-16H2,2-4H3,(H,25,26)/t17-,19?,22+,23+,24+/m1/s1 |
| InChIKey | AJMRDENETZFMIK-JIXWTMKUSA-N |
| XLogP | 5.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|