C10H18N2 — CID 89293408
(2E,4E,6Z)-5-N,5-N-dimethylocta-2,4,6-triene-2,5-diamine (PubChem CID 89293408) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (2E,4E,6Z)-5-N,5-N-dimethylocta-2,4,6-triene-2,5-diamine.
| Compound Name | (2E,4E,6Z)-5-N,5-N-dimethylocta-2,4,6-triene-2,5-diamine |
|---|---|
| PubChem CID | 89293408 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (2E,4E,6Z)-5-N,5-N-dimethylocta-2,4,6-triene-2,5-diamine |
| SMILES | C/C=C\C(=C/C=C(\C)N)N(C)C |
| InChI | InChI=1S/C10H18N2/c1-5-6-10(12(3)4)8-7-9(2)11/h5-8H,11H2,1-4H3/b6-5-,9-7+,10-8+ |
| InChIKey | NEGWDKKRXQKOOP-WDGPHVMXSA-N |
| XLogP | 1.87 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|