C16H29N7O — CID 89293474
N'-[[1-[(2S)-1-(4-tert-butylpiperazin-1-yl)-1-oxopropan-2-yl]triazol-4-yl]methyl]ethanimidamide (PubChem CID 89293474) has the molecular formula C16H29N7O and a molecular weight of 335.46 g/mol. Its IUPAC name is N'-[[1-[(2S)-1-(4-tert-butylpiperazin-1-yl)-1-oxopropan-2-yl]triazol-4-yl]methyl]ethanimidamide.
| Compound Name | N'-[[1-[(2S)-1-(4-tert-butylpiperazin-1-yl)-1-oxopropan-2-yl]triazol-4-yl]methyl]ethanimidamide |
|---|---|
| PubChem CID | 89293474 |
| Molecular Formula | C16H29N7O |
| Molecular Weight | 335.46 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | N'-[[1-[(2S)-1-(4-tert-butylpiperazin-1-yl)-1-oxopropan-2-yl]triazol-4-yl]methyl]ethanimidamide |
| SMILES | C/C(N)=N\Cc1cn([C@@H](C)C(=O)N2CCN(C(C)(C)C)CC2)nn1 |
| InChI | InChI=1S/C16H29N7O/c1-12(23-11-14(19-20-23)10-18-13(2)17)15(24)21-6-8-22(9-7-21)16(3,4)5/h11-12H,6-10H2,1-5H3,(H2,17,18)/t12-/m0/s1 |
| InChIKey | DWLDWBFENGLDJC-LBPRGKRZSA-N |
| XLogP | 0.66 |
| TPSA | 92.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.46 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|