About 2-[[6-(1,1-dicyanoprop-1-en-2-yl)naphthalen-2-yl]-methylamino]ethyl methanesulfonate
2-[[6-(1,1-dicyanoprop-1-en-2-yl)naphthalen-2-yl]-methylamino]ethyl methanesulfonate (PubChem CID 89293673) has the molecular formula C19H19N3O3S
and a molecular weight of 369.45 g/mol. Its IUPAC name is 2-[[6-(1,1-dicyanoprop-1-en-2-yl)naphthalen-2-yl]-methylamino]ethyl methanesulfonate.
Molecular Properties
| Compound Name | 2-[[6-(1,1-dicyanoprop-1-en-2-yl)naphthalen-2-yl]-methylamino]ethyl methanesulfonate |
| PubChem CID | 89293673 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 2-[[6-(1,1-dicyanoprop-1-en-2-yl)naphthalen-2-yl]-methylamino]ethyl methanesulfonate |
| SMILES | CC(=C(C#N)C#N)c1ccc2cc(N(C)CCOS(C)(=O)=O)ccc2c1 |
| InChI | InChI=1S/C19H19N3O3S/c1-14(18(12-20)13-21)15-4-5-17-11-19(7-6-16(17)10-15)22(2)8-9-25-26(3,23)24/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | KZXZIXZXWOFAKJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 94.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[[6-(1,1-dicyanoprop-1-en-2-yl)naphthalen-2-yl]-methylamino]ethyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[6-(1,1-dicyanoprop-1-en-2-yl)naphthalen-2-yl]-methylamino]ethyl methanesulfonate?
The IUPAC name of 2-[[6-(1,1-dicyanoprop-1-en-2-yl)naphthalen-2-yl]-methylamino]ethyl methanesulfonate (CID 89293673) is 2-[[6-(1,1-dicyanoprop-1-en-2-yl)naphthalen-2-yl]-methylamino]ethyl methanesulfonate.
What is the SMILES notation for 2-[[6-(1,1-dicyanoprop-1-en-2-yl)naphthalen-2-yl]-methylamino]ethyl methanesulfonate?
The canonical SMILES for 2-[[6-(1,1-dicyanoprop-1-en-2-yl)naphthalen-2-yl]-methylamino]ethyl methanesulfonate is CC(=C(C#N)C#N)c1ccc2cc(N(C)CCOS(C)(=O)=O)ccc2c1.
What is the InChIKey of 2-[[6-(1,1-dicyanoprop-1-en-2-yl)naphthalen-2-yl]-methylamino]ethyl methanesulfonate?
The InChIKey is KZXZIXZXWOFAKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O3S/c1-14(18(12-20)13-21)15-4-5-17-11-19(7-6-16(17)10-15)22(2)8-9-25-26(3,23)24/h4-7,10-11H,8-9H2,1-3H3.
What are the key properties of 2-[[6-(1,1-dicyanoprop-1-en-2-yl)naphthalen-2-yl]-methylamino]ethyl methanesulfonate?
2-[[6-(1,1-dicyanoprop-1-en-2-yl)naphthalen-2-yl]-methylamino]ethyl methanesulfonate has a molecular weight of 369.45 g/mol, XLogP of 3.07, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[6-(1,1-dicyanoprop-1-en-2-yl)naphthalen-2-yl]-methylamino]ethyl methanesulfonate is sourced from PubChem (CID 89293673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).