C15H24O3Si — CID 89293785
(3aS,7R,7aS)-7-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-6-methylidene-3,3a,7,7a-tetrahydro-1-benzofuran-2-one (PubChem CID 89293785) has the molecular formula C15H24O3Si and a molecular weight of 280.44 g/mol. Its IUPAC name is (3aS,7R,7aS)-7-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-6-methylidene-3,3a,7,7a-tetrahydro-1-benzofuran-2-one.
| Compound Name | (3aS,7R,7aS)-7-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-6-methylidene-3,3a,7,7a-tetrahydro-1-benzofuran-2-one |
|---|---|
| PubChem CID | 89293785 |
| Molecular Formula | C15H24O3Si |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (3aS,7R,7aS)-7-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-6-methylidene-3,3a,7,7a-tetrahydro-1-benzofuran-2-one |
| SMILES | C=C1C=C[C@@H]2CC(=O)O[C@@H]2[C@@H]1CC(C)(C)[Si](C)(C)O |
| InChI | InChI=1S/C15H24O3Si/c1-10-6-7-11-8-13(16)18-14(11)12(10)9-15(2,3)19(4,5)17/h6-7,11-12,14,17H,1,8-9H2,2-5H3/t11-,12-,14+/m1/s1 |
| InChIKey | HALAKOOWGBEXLR-BZPMIXESSA-N |
| XLogP | 3.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|