C19H30N2O3 — CID 89293921
(NZ)-N-[1-[1-[[4-(2-methoxyethoxy)-2,3-dimethylphenyl]methyl]pyrrolidin-2-yl]propan-2-ylidene]hydroxylamine (PubChem CID 89293921) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is (NZ)-N-[1-[1-[[4-(2-methoxyethoxy)-2,3-dimethylphenyl]methyl]pyrrolidin-2-yl]propan-2-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-[1-[[4-(2-methoxyethoxy)-2,3-dimethylphenyl]methyl]pyrrolidin-2-yl]propan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 89293921 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (NZ)-N-[1-[1-[[4-(2-methoxyethoxy)-2,3-dimethylphenyl]methyl]pyrrolidin-2-yl]propan-2-ylidene]hydroxylamine |
| SMILES | COCCOc1ccc(CN2CCCC2C/C(C)=N\O)c(C)c1C |
| InChI | InChI=1S/C19H30N2O3/c1-14(20-22)12-18-6-5-9-21(18)13-17-7-8-19(16(3)15(17)2)24-11-10-23-4/h7-8,18,22H,5-6,9-13H2,1-4H3/b20-14- |
| InChIKey | XJUWUJPPCRTKNF-ZHZULCJRSA-N |
| XLogP | 3.53 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|