About (3Z)-5-methylidenehepta-1,3-diene-1,1-diamine
(3Z)-5-methylidenehepta-1,3-diene-1,1-diamine (PubChem CID 89293968) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is (3Z)-5-methylidenehepta-1,3-diene-1,1-diamine.
Molecular Properties
| Compound Name | (3Z)-5-methylidenehepta-1,3-diene-1,1-diamine |
| PubChem CID | 89293968 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (3Z)-5-methylidenehepta-1,3-diene-1,1-diamine |
| SMILES | C=C(/C=C\C=C(N)N)CC |
| InChI | InChI=1S/C8H14N2/c1-3-7(2)5-4-6-8(9)10/h4-6H,2-3,9-10H2,1H3/b5-4- |
| InChIKey | UEZLCORFTLNSLY-PLNGDYQASA-N |
| XLogP | 1.27 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-5-methylidenehepta-1,3-diene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-5-methylidenehepta-1,3-diene-1,1-diamine?
The IUPAC name of (3Z)-5-methylidenehepta-1,3-diene-1,1-diamine (CID 89293968) is (3Z)-5-methylidenehepta-1,3-diene-1,1-diamine.
What is the SMILES notation for (3Z)-5-methylidenehepta-1,3-diene-1,1-diamine?
The canonical SMILES for (3Z)-5-methylidenehepta-1,3-diene-1,1-diamine is C=C(/C=C\C=C(N)N)CC.
What is the InChIKey of (3Z)-5-methylidenehepta-1,3-diene-1,1-diamine?
The InChIKey is UEZLCORFTLNSLY-PLNGDYQASA-N. The full InChI is InChI=1S/C8H14N2/c1-3-7(2)5-4-6-8(9)10/h4-6H,2-3,9-10H2,1H3/b5-4-.
What are the key properties of (3Z)-5-methylidenehepta-1,3-diene-1,1-diamine?
(3Z)-5-methylidenehepta-1,3-diene-1,1-diamine has a molecular weight of 138.21 g/mol, XLogP of 1.27, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-5-methylidenehepta-1,3-diene-1,1-diamine is sourced from PubChem (CID 89293968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).