C22H19N5O2 — CID 89294199
1-[4-[3-[1-(4-methoxyphenyl)cyclopropyl]-[1,2,4]triazolo[4,3-b][1,2,4]triazin-6-yl]phenyl]ethenol (PubChem CID 89294199) has the molecular formula C22H19N5O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is 1-[4-[3-[1-(4-methoxyphenyl)cyclopropyl]-[1,2,4]triazolo[4,3-b][1,2,4]triazin-6-yl]phenyl]ethenol.
| Compound Name | 1-[4-[3-[1-(4-methoxyphenyl)cyclopropyl]-[1,2,4]triazolo[4,3-b][1,2,4]triazin-6-yl]phenyl]ethenol |
|---|---|
| PubChem CID | 89294199 |
| Molecular Formula | C22H19N5O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 1-[4-[3-[1-(4-methoxyphenyl)cyclopropyl]-[1,2,4]triazolo[4,3-b][1,2,4]triazin-6-yl]phenyl]ethenol |
| SMILES | C=C(O)c1ccc(-c2cnc3nnc(C4(c5ccc(OC)cc5)CC4)n3n2)cc1 |
| InChI | InChI=1S/C22H19N5O2/c1-14(28)15-3-5-16(6-4-15)19-13-23-21-25-24-20(27(21)26-19)22(11-12-22)17-7-9-18(29-2)10-8-17/h3-10,13,28H,1,11-12H2,2H3 |
| InChIKey | KXMKHFRPGCZXEJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|