C24H24N2O2S — CID 89294412
phenyl-[2-[3-[4-(1-phenylethenyl)-4,5-dihydro-1,3-oxazol-2-yl]propyl]-4,5-dihydro-1,3-oxazol-4-yl]methanethione (PubChem CID 89294412) has the molecular formula C24H24N2O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is phenyl-[2-[3-[4-(1-phenylethenyl)-4,5-dihydro-1,3-oxazol-2-yl]propyl]-4,5-dihydro-1,3-oxazol-4-yl]methanethione.
| Compound Name | phenyl-[2-[3-[4-(1-phenylethenyl)-4,5-dihydro-1,3-oxazol-2-yl]propyl]-4,5-dihydro-1,3-oxazol-4-yl]methanethione |
|---|---|
| PubChem CID | 89294412 |
| Molecular Formula | C24H24N2O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | phenyl-[2-[3-[4-(1-phenylethenyl)-4,5-dihydro-1,3-oxazol-2-yl]propyl]-4,5-dihydro-1,3-oxazol-4-yl]methanethione |
| SMILES | C=C(c1ccccc1)C1COC(CCCC2=NC(C(=S)c3ccccc3)CO2)=N1 |
| InChI | InChI=1S/C24H24N2O2S/c1-17(18-9-4-2-5-10-18)20-15-27-22(25-20)13-8-14-23-26-21(16-28-23)24(29)19-11-6-3-7-12-19/h2-7,9-12,20-21H,1,8,13-16H2 |
| InChIKey | HHSXFAYSUOKQEQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|