C13H20N2 — CID 89294669
(2E,4E)-8-(ethylamino)-4,6-dimethylnona-2,4,8-trienenitrile (PubChem CID 89294669) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (2E,4E)-8-(ethylamino)-4,6-dimethylnona-2,4,8-trienenitrile.
| Compound Name | (2E,4E)-8-(ethylamino)-4,6-dimethylnona-2,4,8-trienenitrile |
|---|---|
| PubChem CID | 89294669 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (2E,4E)-8-(ethylamino)-4,6-dimethylnona-2,4,8-trienenitrile |
| SMILES | C=C(CC(C)/C=C(C)/C=C/C#N)NCC |
| InChI | InChI=1S/C13H20N2/c1-5-15-13(4)10-12(3)9-11(2)7-6-8-14/h6-7,9,12,15H,4-5,10H2,1-3H3/b7-6+,11-9+ |
| InChIKey | JLLWQLFMNCHKOJ-RXUIJTJXSA-N |
| XLogP | 3.16 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|