C33H42N4O3 — CID 89295070
3-amino-5-tert-butyl-2-methoxy-N-[4-methyl-3-[4-[(1-methylpiperidin-2-yl)methylcarbamoyl]phenyl]phenyl]benzamide (PubChem CID 89295070) has the molecular formula C33H42N4O3 and a molecular weight of 542.72 g/mol. Its IUPAC name is 3-amino-5-tert-butyl-2-methoxy-N-[4-methyl-3-[4-[(1-methylpiperidin-2-yl)methylcarbamoyl]phenyl]phenyl]benzamide.
| Compound Name | 3-amino-5-tert-butyl-2-methoxy-N-[4-methyl-3-[4-[(1-methylpiperidin-2-yl)methylcarbamoyl]phenyl]phenyl]benzamide |
|---|---|
| PubChem CID | 89295070 |
| Molecular Formula | C33H42N4O3 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.33 |
| IUPAC Name | 3-amino-5-tert-butyl-2-methoxy-N-[4-methyl-3-[4-[(1-methylpiperidin-2-yl)methylcarbamoyl]phenyl]phenyl]benzamide |
| SMILES | COc1c(N)cc(C(C)(C)C)cc1C(=O)Nc1ccc(C)c(-c2ccc(C(=O)NCC3CCCCN3C)cc2)c1 |
| InChI | InChI=1S/C33H42N4O3/c1-21-10-15-25(36-32(39)28-17-24(33(2,3)4)18-29(34)30(28)40-6)19-27(21)22-11-13-23(14-12-22)31(38)35-20-26-9-7-8-16-37(26)5/h10-15,17-19,26H,7-9,16,20,34H2,1-6H3,(H,35,38)(H,36,39) |
| InChIKey | QAPNSQSVRVTVRZ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|