C9H3F10O4PS2 — CID 89295566
[4-[bis(trifluoromethylsulfonyl)methyl]-2,3,5,6-tetrafluorophenyl]phosphane (PubChem CID 89295566) has the molecular formula C9H3F10O4PS2 and a molecular weight of 460.21 g/mol. Its IUPAC name is [4-[bis(trifluoromethylsulfonyl)methyl]-2,3,5,6-tetrafluorophenyl]phosphane.
| Compound Name | [4-[bis(trifluoromethylsulfonyl)methyl]-2,3,5,6-tetrafluorophenyl]phosphane |
|---|---|
| PubChem CID | 89295566 |
| Molecular Formula | C9H3F10O4PS2 |
| Molecular Weight | 460.21 g/mol |
| Exact Mass | 459.91 |
| IUPAC Name | [4-[bis(trifluoromethylsulfonyl)methyl]-2,3,5,6-tetrafluorophenyl]phosphane |
| SMILES | O=S(=O)(C(c1c(F)c(F)c(P)c(F)c1F)S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H3F10O4PS2/c10-2-1(3(11)5(13)6(24)4(2)12)7(25(20,21)8(14,15)16)26(22,23)9(17,18)19/h7H,24H2 |
| InChIKey | IUPACUKTGRORSU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.21 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|