C8H10ClNO2 — CID 89295649
(2E,4Z,6E)-3-chloro-6-nitroocta-2,4,6-triene (PubChem CID 89295649) has the molecular formula C8H10ClNO2 and a molecular weight of 187.63 g/mol. Its IUPAC name is (2E,4Z,6E)-3-chloro-6-nitroocta-2,4,6-triene.
| Compound Name | (2E,4Z,6E)-3-chloro-6-nitroocta-2,4,6-triene |
|---|---|
| PubChem CID | 89295649 |
| Molecular Formula | C8H10ClNO2 |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | (2E,4Z,6E)-3-chloro-6-nitroocta-2,4,6-triene |
| SMILES | C/C=C(Cl)\C=C/C(=C\C)[N+](=O)[O-] |
| InChI | InChI=1S/C8H10ClNO2/c1-3-7(9)5-6-8(4-2)10(11)12/h3-6H,1-2H3/b6-5-,7-3+,8-4+ |
| InChIKey | CBZWFHDKPNOCDG-CRBAZOTPSA-N |
| XLogP | 2.87 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|