About 3,4-dinitropyrazole-1,5-diamine
3,4-dinitropyrazole-1,5-diamine (PubChem CID 89295953) has the molecular formula C3H4N6O4
and a molecular weight of 188.10 g/mol. Its IUPAC name is 3,4-dinitropyrazole-1,5-diamine.
Molecular Properties
| Compound Name | 3,4-dinitropyrazole-1,5-diamine |
| PubChem CID | 89295953 |
| Molecular Formula | C3H4N6O4 |
| Molecular Weight | 188.10 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 3,4-dinitropyrazole-1,5-diamine |
| SMILES | Nc1c([N+](=O)[O-])c([N+](=O)[O-])nn1N |
| InChI | InChI=1S/C3H4N6O4/c4-2-1(8(10)11)3(9(12)13)6-7(2)5/h4-5H2 |
| InChIKey | DQMWDSJXFNLICU-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 156.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.10 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dinitropyrazole-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dinitropyrazole-1,5-diamine?
The IUPAC name of 3,4-dinitropyrazole-1,5-diamine (CID 89295953) is 3,4-dinitropyrazole-1,5-diamine.
What is the SMILES notation for 3,4-dinitropyrazole-1,5-diamine?
The canonical SMILES for 3,4-dinitropyrazole-1,5-diamine is Nc1c([N+](=O)[O-])c([N+](=O)[O-])nn1N.
What is the InChIKey of 3,4-dinitropyrazole-1,5-diamine?
The InChIKey is DQMWDSJXFNLICU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N6O4/c4-2-1(8(10)11)3(9(12)13)6-7(2)5/h4-5H2.
What are the key properties of 3,4-dinitropyrazole-1,5-diamine?
3,4-dinitropyrazole-1,5-diamine has a molecular weight of 188.10 g/mol, XLogP of -1.00, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dinitropyrazole-1,5-diamine is sourced from PubChem (CID 89295953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).