C41H38B2N2O4 — CID 89295968
5-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]-11-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indolo[3,2-b]carbazole (PubChem CID 89295968) has the molecular formula C41H38B2N2O4 and a molecular weight of 644.39 g/mol. Its IUPAC name is 5-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]-11-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indolo[3,2-b]carbazole.
| Compound Name | 5-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]-11-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indolo[3,2-b]carbazole |
|---|---|
| PubChem CID | 89295968 |
| Molecular Formula | C41H38B2N2O4 |
| Molecular Weight | 644.39 g/mol |
| Exact Mass | 644.30 |
| IUPAC Name | 5-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]-11-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indolo[3,2-b]carbazole |
| SMILES | C=C1OB(c2ccc(-n3c4ccccc4c4cc5c(cc43)c3ccccc3n5-c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C41H38B2N2O4/c1-26-39(2,3)47-42(46-26)27-16-20-29(21-17-27)44-35-14-10-8-12-31(35)33-25-38-34(24-37(33)44)32-13-9-11-15-36(32)45(38)30-22-18-28(19-23-30)43-48-40(4,5)41(6,7)49-43/h8-25H,1H2,2-7H3 |
| InChIKey | VDCRKYBVCUNJML-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 46.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.39 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|