(1,3-dioxoisoindol-2-yl)methyl furan-2-carboxylate

C14H9NO5 — CID 892962

IUPAC(1,3-dioxoisoindol-2-yl)methyl furan-2-carboxylate
SMILESO=C(OCN1C(=O)c2ccccc2C1=O)c1ccco1
InChIInChI=1S/C14H9NO5/c16-12-9-4-1-2-5-10(9)13(17)15(12)8-20-14(18)11-6-3-7-19-11/h1-7H,8H2
InChIKeyUZJJXGGPKFMCCV-UHFFFAOYSA-N
MW271.23 g/mol
LogP1.69
Rot. Bonds3

About (1,3-dioxoisoindol-2-yl)methyl furan-2-carboxylate

(1,3-dioxoisoindol-2-yl)methyl furan-2-carboxylate (PubChem CID 892962) has the molecular formula C14H9NO5 and a molecular weight of 271.23 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl furan-2-carboxylate.

Molecular Properties

Compound Name(1,3-dioxoisoindol-2-yl)methyl furan-2-carboxylate
PubChem CID892962
Molecular FormulaC14H9NO5
Molecular Weight271.23 g/mol
Exact Mass271.05
IUPAC Name(1,3-dioxoisoindol-2-yl)methyl furan-2-carboxylate
SMILESO=C(OCN1C(=O)c2ccccc2C1=O)c1ccco1
InChIInChI=1S/C14H9NO5/c16-12-9-4-1-2-5-10(9)13(17)15(12)8-20-14(18)11-6-3-7-19-11/h1-7H,8H2
InChIKeyUZJJXGGPKFMCCV-UHFFFAOYSA-N
XLogP1.69
TPSA76.82 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.23
LogP ≤ 51.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze (1,3-dioxoisoindol-2-yl)methyl furan-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,3-dioxoisoindol-2-yl)methyl furan-2-carboxylate?
The IUPAC name of (1,3-dioxoisoindol-2-yl)methyl furan-2-carboxylate (CID 892962) is (1,3-dioxoisoindol-2-yl)methyl furan-2-carboxylate.
What is the SMILES notation for (1,3-dioxoisoindol-2-yl)methyl furan-2-carboxylate?
The canonical SMILES for (1,3-dioxoisoindol-2-yl)methyl furan-2-carboxylate is O=C(OCN1C(=O)c2ccccc2C1=O)c1ccco1.
What is the InChIKey of (1,3-dioxoisoindol-2-yl)methyl furan-2-carboxylate?
The InChIKey is UZJJXGGPKFMCCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO5/c16-12-9-4-1-2-5-10(9)13(17)15(12)8-20-14(18)11-6-3-7-19-11/h1-7H,8H2.
What are the key properties of (1,3-dioxoisoindol-2-yl)methyl furan-2-carboxylate?
(1,3-dioxoisoindol-2-yl)methyl furan-2-carboxylate has a molecular weight of 271.23 g/mol, XLogP of 1.69, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dioxoisoindol-2-yl)methyl furan-2-carboxylate is sourced from PubChem (CID 892962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).