C26H36N2O4 — CID 89296464
(4'S,6R)-4'-(5-but-3-enylfuran-3-yl)-1'-hex-5-enyl-3,3-dimethylspiro[7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,3'-piperidine]-2',5-dione (PubChem CID 89296464) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is (4'S,6R)-4'-(5-but-3-enylfuran-3-yl)-1'-hex-5-enyl-3,3-dimethylspiro[7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,3'-piperidine]-2',5-dione.
| Compound Name | (4'S,6R)-4'-(5-but-3-enylfuran-3-yl)-1'-hex-5-enyl-3,3-dimethylspiro[7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,3'-piperidine]-2',5-dione |
|---|---|
| PubChem CID | 89296464 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | (4'S,6R)-4'-(5-but-3-enylfuran-3-yl)-1'-hex-5-enyl-3,3-dimethylspiro[7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,3'-piperidine]-2',5-dione |
| SMILES | C=CCCCCN1CC[C@@H](c2coc(CCC=C)c2)[C@]2(CC3COC(C)(C)N3C2=O)C1=O |
| InChI | InChI=1S/C26H36N2O4/c1-5-7-9-10-13-27-14-12-22(19-15-21(31-17-19)11-8-6-2)26(23(27)29)16-20-18-32-25(3,4)28(20)24(26)30/h5-6,15,17,20,22H,1-2,7-14,16,18H2,3-4H3/t20?,22-,26+/m0/s1 |
| InChIKey | CMAFBZRZLFMAHI-CPNSHCRNSA-N |
| XLogP | 4.42 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|