C11H23N2O+ — CID 89296573
1-(4,4-dimethylpiperazin-4-ium-1-yl)-3-methylbutan-1-one (PubChem CID 89296573) has the molecular formula C11H23N2O+ and a molecular weight of 199.32 g/mol. Its IUPAC name is 1-(4,4-dimethylpiperazin-4-ium-1-yl)-3-methylbutan-1-one.
| Compound Name | 1-(4,4-dimethylpiperazin-4-ium-1-yl)-3-methylbutan-1-one |
|---|---|
| PubChem CID | 89296573 |
| Molecular Formula | C11H23N2O+ |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.18 |
| IUPAC Name | 1-(4,4-dimethylpiperazin-4-ium-1-yl)-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)N1CC[N+](C)(C)CC1 |
| InChI | InChI=1S/C11H23N2O/c1-10(2)9-11(14)12-5-7-13(3,4)8-6-12/h10H,5-9H2,1-4H3/q+1 |
| InChIKey | WKWUUXMRYRKVQP-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|