C40H29N — CID 89296767
3-[4-(9,9-dimethylfluoren-2-yl)phenyl]-10a,12b-dihydropyreno[1,2-b]pyridine (PubChem CID 89296767) has the molecular formula C40H29N and a molecular weight of 523.68 g/mol. Its IUPAC name is 3-[4-(9,9-dimethylfluoren-2-yl)phenyl]-10a,12b-dihydropyreno[1,2-b]pyridine.
| Compound Name | 3-[4-(9,9-dimethylfluoren-2-yl)phenyl]-10a,12b-dihydropyreno[1,2-b]pyridine |
|---|---|
| PubChem CID | 89296767 |
| Molecular Formula | C40H29N |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 3-[4-(9,9-dimethylfluoren-2-yl)phenyl]-10a,12b-dihydropyreno[1,2-b]pyridine |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc(C4=C5C=CC6=C7C(=CC=C(C=C4)C57)C4N=CC=CC4=C6)cc3)cc21 |
| InChI | InChI=1S/C40H29N/c1-40(2)35-8-4-3-7-31(35)32-18-15-27(23-36(32)40)24-9-11-25(12-10-24)30-17-13-26-14-20-34-38-28(16-19-33(30)37(26)38)22-29-6-5-21-41-39(29)34/h3-23,37,39H,1-2H3 |
| InChIKey | VDAATAMFVQCXER-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |