C46H33N — CID 89296805
3-[4-(9,9-dimethylfluoren-2-yl)phenyl]-8-phenyl-10a,12b-dihydropyreno[1,2-b]pyridine (PubChem CID 89296805) has the molecular formula C46H33N and a molecular weight of 599.78 g/mol. Its IUPAC name is 3-[4-(9,9-dimethylfluoren-2-yl)phenyl]-8-phenyl-10a,12b-dihydropyreno[1,2-b]pyridine.
| Compound Name | 3-[4-(9,9-dimethylfluoren-2-yl)phenyl]-8-phenyl-10a,12b-dihydropyreno[1,2-b]pyridine |
|---|---|
| PubChem CID | 89296805 |
| Molecular Formula | C46H33N |
| Molecular Weight | 599.78 g/mol |
| Exact Mass | 599.26 |
| IUPAC Name | 3-[4-(9,9-dimethylfluoren-2-yl)phenyl]-8-phenyl-10a,12b-dihydropyreno[1,2-b]pyridine |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc(C4=C5C=CC6=C7C(=CC=C(C=C4)C57)C4N=CC(c5ccccc5)=CC4=C6)cc3)cc21 |
| InChI | InChI=1S/C46H33N/c1-46(2)41-11-7-6-10-37(41)38-21-18-32(26-42(38)46)29-12-14-30(15-13-29)36-20-16-31-17-23-40-44-33(19-22-39(36)43(31)44)24-34-25-35(27-47-45(34)40)28-8-4-3-5-9-28/h3-27,43,45H,1-2H3 |
| InChIKey | UVTQVOLSBRYJEP-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.78 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |