C39H55N5O4Si2 — CID 89296881
5-[5-[5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]-2-methoxybenzaldehyde (PubChem CID 89296881) has the molecular formula C39H55N5O4Si2 and a molecular weight of 714.07 g/mol. Its IUPAC name is 5-[5-[5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]-2-methoxybenzaldehyde.
| Compound Name | 5-[5-[5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]-2-methoxybenzaldehyde |
|---|---|
| PubChem CID | 89296881 |
| Molecular Formula | C39H55N5O4Si2 |
| Molecular Weight | 714.07 g/mol |
| Exact Mass | 713.38 |
| IUPAC Name | 5-[5-[5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]-2-methoxybenzaldehyde |
| SMILES | COc1ccc(-c2ccc(-c3cnn4c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)cc(C5C[C@H]6CC[C@@H](C5)C6)nc34)cn2)cc1C=O |
| InChI | InChI=1S/C39H55N5O4Si2/c1-46-37-13-11-30(21-33(37)25-45)35-12-10-31(23-40-35)34-24-41-44-38(22-36(42-39(34)44)32-19-28-8-9-29(18-28)20-32)43(26-47-14-16-49(2,3)4)27-48-15-17-50(5,6)7/h10-13,21-25,28-29,32H,8-9,14-20,26-27H2,1-7H3/t28-,29+,32? |
| InChIKey | SWIZQYYDZLZGJY-LSICZBSXSA-N |
| XLogP | 9.00 |
| TPSA | 91.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.07 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|