C31H47ClFN5O2Si2 — CID 89296896
5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-3-(6-chloro-5-fluoro-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 89296896) has the molecular formula C31H47ClFN5O2Si2 and a molecular weight of 632.37 g/mol. Its IUPAC name is 5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-3-(6-chloro-5-fluoro-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-3-(6-chloro-5-fluoro-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 89296896 |
| Molecular Formula | C31H47ClFN5O2Si2 |
| Molecular Weight | 632.37 g/mol |
| Exact Mass | 631.29 |
| IUPAC Name | 5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-3-(6-chloro-5-fluoro-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(C2C[C@H]3CC[C@@H](C2)C3)nc2c(-c3cnc(Cl)c(F)c3)cnn12 |
| InChI | InChI=1S/C31H47ClFN5O2Si2/c1-41(2,3)11-9-39-20-37(21-40-10-12-42(4,5)6)29-17-28(24-14-22-7-8-23(13-22)15-24)36-31-26(19-35-38(29)31)25-16-27(33)30(32)34-18-25/h16-19,22-24H,7-15,20-21H2,1-6H3/t22-,23+,24? |
| InChIKey | LOEISGGWVGUUCE-VSGJHWFKSA-N |
| XLogP | 8.31 |
| TPSA | 64.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.37 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|