About 1-cyclohexa-1,5-dien-1-yl-3-(methylamino)propan-1-ol
1-cyclohexa-1,5-dien-1-yl-3-(methylamino)propan-1-ol (PubChem CID 89296934) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-3-(methylamino)propan-1-ol.
Molecular Properties
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-3-(methylamino)propan-1-ol |
| PubChem CID | 89296934 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-3-(methylamino)propan-1-ol |
| SMILES | CNCCC(O)C1=CCCC=C1 |
| InChI | InChI=1S/C10H17NO/c1-11-8-7-10(12)9-5-3-2-4-6-9/h3,5-6,10-12H,2,4,7-8H2,1H3 |
| InChIKey | FUBOWAVBGLQUGL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclohexa-1,5-dien-1-yl-3-(methylamino)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,5-dien-1-yl-3-(methylamino)propan-1-ol?
The IUPAC name of 1-cyclohexa-1,5-dien-1-yl-3-(methylamino)propan-1-ol (CID 89296934) is 1-cyclohexa-1,5-dien-1-yl-3-(methylamino)propan-1-ol.
What is the SMILES notation for 1-cyclohexa-1,5-dien-1-yl-3-(methylamino)propan-1-ol?
The canonical SMILES for 1-cyclohexa-1,5-dien-1-yl-3-(methylamino)propan-1-ol is CNCCC(O)C1=CCCC=C1.
What is the InChIKey of 1-cyclohexa-1,5-dien-1-yl-3-(methylamino)propan-1-ol?
The InChIKey is FUBOWAVBGLQUGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-11-8-7-10(12)9-5-3-2-4-6-9/h3,5-6,10-12H,2,4,7-8H2,1H3.
What are the key properties of 1-cyclohexa-1,5-dien-1-yl-3-(methylamino)propan-1-ol?
1-cyclohexa-1,5-dien-1-yl-3-(methylamino)propan-1-ol has a molecular weight of 167.25 g/mol, XLogP of 1.23, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,5-dien-1-yl-3-(methylamino)propan-1-ol is sourced from PubChem (CID 89296934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).