C27H29NO4Si — CID 89297065
N-(4-triethoxysilylphenyl)anthracene-1-carboxamide (PubChem CID 89297065) has the molecular formula C27H29NO4Si and a molecular weight of 459.62 g/mol. Its IUPAC name is N-(4-triethoxysilylphenyl)anthracene-1-carboxamide.
| Compound Name | N-(4-triethoxysilylphenyl)anthracene-1-carboxamide |
|---|---|
| PubChem CID | 89297065 |
| Molecular Formula | C27H29NO4Si |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | N-(4-triethoxysilylphenyl)anthracene-1-carboxamide |
| SMILES | CCO[Si](OCC)(OCC)c1ccc(NC(=O)c2cccc3cc4ccccc4cc23)cc1 |
| InChI | InChI=1S/C27H29NO4Si/c1-4-30-33(31-5-2,32-6-3)24-16-14-23(15-17-24)28-27(29)25-13-9-12-22-18-20-10-7-8-11-21(20)19-26(22)25/h7-19H,4-6H2,1-3H3,(H,28,29) |
| InChIKey | FEUZYEDQUMAZSE-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|