C31H17F17O2S — CID 89297080
[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)phenyl] anthracene-9-carboxylate (PubChem CID 89297080) has the molecular formula C31H17F17O2S and a molecular weight of 776.51 g/mol. Its IUPAC name is [4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)phenyl] anthracene-9-carboxylate.
| Compound Name | [4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)phenyl] anthracene-9-carboxylate |
|---|---|
| PubChem CID | 89297080 |
| Molecular Formula | C31H17F17O2S |
| Molecular Weight | 776.51 g/mol |
| Exact Mass | 776.07 |
| IUPAC Name | [4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)phenyl] anthracene-9-carboxylate |
| SMILES | O=C(Oc1ccc(SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C31H17F17O2S/c32-24(33,25(34,35)26(36,37)27(38,39)28(40,41)29(42,43)30(44,45)31(46,47)48)13-14-51-19-11-9-18(10-12-19)50-23(49)22-20-7-3-1-5-16(20)15-17-6-2-4-8-21(17)22/h1-12,15H,13-14H2 |
| InChIKey | HXNJHNTUPFWKLO-UHFFFAOYSA-N |
| XLogP | 11.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.51 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|