About N-butan-2-yl-N'-[(3E)-2-methylpenta-1,3-dien-3-yl]methanediamine
N-butan-2-yl-N'-[(3E)-2-methylpenta-1,3-dien-3-yl]methanediamine (PubChem CID 89297356) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is N-butan-2-yl-N'-[(3E)-2-methylpenta-1,3-dien-3-yl]methanediamine.
Molecular Properties
| Compound Name | N-butan-2-yl-N'-[(3E)-2-methylpenta-1,3-dien-3-yl]methanediamine |
| PubChem CID | 89297356 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | N-butan-2-yl-N'-[(3E)-2-methylpenta-1,3-dien-3-yl]methanediamine |
| SMILES | C=C(C)/C(=C\C)NCNC(C)CC |
| InChI | InChI=1S/C11H22N2/c1-6-10(5)12-8-13-11(7-2)9(3)4/h7,10,12-13H,3,6,8H2,1-2,4-5H3/b11-7+ |
| InChIKey | XXSYSDVTMQAYDU-YRNVUSSQSA-N |
| XLogP | 2.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-yl-N'-[(3E)-2-methylpenta-1,3-dien-3-yl]methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-N'-[(3E)-2-methylpenta-1,3-dien-3-yl]methanediamine?
The IUPAC name of N-butan-2-yl-N'-[(3E)-2-methylpenta-1,3-dien-3-yl]methanediamine (CID 89297356) is N-butan-2-yl-N'-[(3E)-2-methylpenta-1,3-dien-3-yl]methanediamine.
What is the SMILES notation for N-butan-2-yl-N'-[(3E)-2-methylpenta-1,3-dien-3-yl]methanediamine?
The canonical SMILES for N-butan-2-yl-N'-[(3E)-2-methylpenta-1,3-dien-3-yl]methanediamine is C=C(C)/C(=C\C)NCNC(C)CC.
What is the InChIKey of N-butan-2-yl-N'-[(3E)-2-methylpenta-1,3-dien-3-yl]methanediamine?
The InChIKey is XXSYSDVTMQAYDU-YRNVUSSQSA-N. The full InChI is InChI=1S/C11H22N2/c1-6-10(5)12-8-13-11(7-2)9(3)4/h7,10,12-13H,3,6,8H2,1-2,4-5H3/b11-7+.
What are the key properties of N-butan-2-yl-N'-[(3E)-2-methylpenta-1,3-dien-3-yl]methanediamine?
N-butan-2-yl-N'-[(3E)-2-methylpenta-1,3-dien-3-yl]methanediamine has a molecular weight of 182.31 g/mol, XLogP of 2.40, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-N'-[(3E)-2-methylpenta-1,3-dien-3-yl]methanediamine is sourced from PubChem (CID 89297356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).