C26H14N4O8S2 — CID 89297431
11,16-dioxo-3,10,17,24-tetrazaoctacyclo[13.13.2.02,10.04,9.012,29.017,25.018,23.026,30]triaconta-1(29),2,4(9),5,7,12,14,18(23),19,21,26(30),27-dodecaene-6,21-disulfonic acid (PubChem CID 89297431) has the molecular formula C26H14N4O8S2 and a molecular weight of 574.55 g/mol. Its IUPAC name is 11,16-dioxo-3,10,17,24-tetrazaoctacyclo[13.13.2.02,10.04,9.012,29.017,25.018,23.026,30]triaconta-1(29),2,4(9),5,7,12,14,18(23),19,21,26(30),27-dodecaene-6,21-disulfonic acid.
| Compound Name | 11,16-dioxo-3,10,17,24-tetrazaoctacyclo[13.13.2.02,10.04,9.012,29.017,25.018,23.026,30]triaconta-1(29),2,4(9),5,7,12,14,18(23),19,21,26(30),27-dodecaene-6,21-disulfonic acid |
|---|---|
| PubChem CID | 89297431 |
| Molecular Formula | C26H14N4O8S2 |
| Molecular Weight | 574.55 g/mol |
| Exact Mass | 574.03 |
| IUPAC Name | 11,16-dioxo-3,10,17,24-tetrazaoctacyclo[13.13.2.02,10.04,9.012,29.017,25.018,23.026,30]triaconta-1(29),2,4(9),5,7,12,14,18(23),19,21,26(30),27-dodecaene-6,21-disulfonic acid |
| SMILES | O=C1c2ccc3c(=O)n4c5ccc(S(=O)(=O)O)cc5nc4c4ccc(c2c34)C2Nc3cc(S(=O)(=O)O)ccc3N12 |
| InChI | InChI=1S/C26H14N4O8S2/c31-25-15-5-6-16-22-14(24-28-18-10-12(40(36,37)38)2-8-20(18)30(24)26(16)32)4-3-13(21(15)22)23-27-17-9-11(39(33,34)35)1-7-19(17)29(23)25/h1-10,23,27H,(H,33,34,35)(H,36,37,38) |
| InChIKey | FKGMMCPSJAQFAO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 175.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.55 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|