About N-(4-cyclohexyl-1,3-thiazol-2-yl)-2-(4-methoxyphenyl)sulfanyl-2-methylpropanamide
N-(4-cyclohexyl-1,3-thiazol-2-yl)-2-(4-methoxyphenyl)sulfanyl-2-methylpropanamide (PubChem CID 89297465) has the molecular formula C20H26N2O2S2
and a molecular weight of 390.57 g/mol. Its IUPAC name is N-(4-cyclohexyl-1,3-thiazol-2-yl)-2-(4-methoxyphenyl)sulfanyl-2-methylpropanamide.
Molecular Properties
| Compound Name | N-(4-cyclohexyl-1,3-thiazol-2-yl)-2-(4-methoxyphenyl)sulfanyl-2-methylpropanamide |
| PubChem CID | 89297465 |
| Molecular Formula | C20H26N2O2S2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-(4-cyclohexyl-1,3-thiazol-2-yl)-2-(4-methoxyphenyl)sulfanyl-2-methylpropanamide |
| SMILES | COc1ccc(SC(C)(C)C(=O)Nc2nc(C3CCCCC3)cs2)cc1 |
| InChI | InChI=1S/C20H26N2O2S2/c1-20(2,26-16-11-9-15(24-3)10-12-16)18(23)22-19-21-17(13-25-19)14-7-5-4-6-8-14/h9-14H,4-8H2,1-3H3,(H,21,22,23) |
| InChIKey | ACYMBQRXUQYSHA-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-cyclohexyl-1,3-thiazol-2-yl)-2-(4-methoxyphenyl)sulfanyl-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-cyclohexyl-1,3-thiazol-2-yl)-2-(4-methoxyphenyl)sulfanyl-2-methylpropanamide?
The IUPAC name of N-(4-cyclohexyl-1,3-thiazol-2-yl)-2-(4-methoxyphenyl)sulfanyl-2-methylpropanamide (CID 89297465) is N-(4-cyclohexyl-1,3-thiazol-2-yl)-2-(4-methoxyphenyl)sulfanyl-2-methylpropanamide.
What is the SMILES notation for N-(4-cyclohexyl-1,3-thiazol-2-yl)-2-(4-methoxyphenyl)sulfanyl-2-methylpropanamide?
The canonical SMILES for N-(4-cyclohexyl-1,3-thiazol-2-yl)-2-(4-methoxyphenyl)sulfanyl-2-methylpropanamide is COc1ccc(SC(C)(C)C(=O)Nc2nc(C3CCCCC3)cs2)cc1.
What is the InChIKey of N-(4-cyclohexyl-1,3-thiazol-2-yl)-2-(4-methoxyphenyl)sulfanyl-2-methylpropanamide?
The InChIKey is ACYMBQRXUQYSHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2O2S2/c1-20(2,26-16-11-9-15(24-3)10-12-16)18(23)22-19-21-17(13-25-19)14-7-5-4-6-8-14/h9-14H,4-8H2,1-3H3,(H,21,22,23).
What are the key properties of N-(4-cyclohexyl-1,3-thiazol-2-yl)-2-(4-methoxyphenyl)sulfanyl-2-methylpropanamide?
N-(4-cyclohexyl-1,3-thiazol-2-yl)-2-(4-methoxyphenyl)sulfanyl-2-methylpropanamide has a molecular weight of 390.57 g/mol, XLogP of 5.71, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-cyclohexyl-1,3-thiazol-2-yl)-2-(4-methoxyphenyl)sulfanyl-2-methylpropanamide is sourced from PubChem (CID 89297465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).