C31H58F2O6Si — CID 89297497
(9S)-12-[tert-butyl(dimethyl)silyl]oxy-13,13-difluoro-9-[(1R)-1-(oxan-2-yloxy)-3-oxopropyl]heptadecanoic acid (PubChem CID 89297497) has the molecular formula C31H58F2O6Si and a molecular weight of 592.88 g/mol. Its IUPAC name is (9S)-12-[tert-butyl(dimethyl)silyl]oxy-13,13-difluoro-9-[(1R)-1-(oxan-2-yloxy)-3-oxopropyl]heptadecanoic acid.
| Compound Name | (9S)-12-[tert-butyl(dimethyl)silyl]oxy-13,13-difluoro-9-[(1R)-1-(oxan-2-yloxy)-3-oxopropyl]heptadecanoic acid |
|---|---|
| PubChem CID | 89297497 |
| Molecular Formula | C31H58F2O6Si |
| Molecular Weight | 592.88 g/mol |
| Exact Mass | 592.40 |
| IUPAC Name | (9S)-12-[tert-butyl(dimethyl)silyl]oxy-13,13-difluoro-9-[(1R)-1-(oxan-2-yloxy)-3-oxopropyl]heptadecanoic acid |
| SMILES | CCCCC(F)(F)C(CC[C@H](CCCCCCCC(=O)O)[C@@H](CC=O)OC1CCCCO1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H58F2O6Si/c1-7-8-22-31(32,33)27(39-40(5,6)30(2,3)4)20-19-25(16-12-10-9-11-13-17-28(35)36)26(21-23-34)38-29-18-14-15-24-37-29/h23,25-27,29H,7-22,24H2,1-6H3,(H,35,36)/t25-,26+,27?,29?/m0/s1 |
| InChIKey | ZXFCRTGVBGNVSY-KPEUBWTESA-N |
| XLogP | 8.91 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.88 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|