About 1-(cyclohexa-2,4-dien-1-ylmethoxy)-3-methoxypropan-2-amine
1-(cyclohexa-2,4-dien-1-ylmethoxy)-3-methoxypropan-2-amine (PubChem CID 89297529) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-(cyclohexa-2,4-dien-1-ylmethoxy)-3-methoxypropan-2-amine.
Molecular Properties
| Compound Name | 1-(cyclohexa-2,4-dien-1-ylmethoxy)-3-methoxypropan-2-amine |
| PubChem CID | 89297529 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 1-(cyclohexa-2,4-dien-1-ylmethoxy)-3-methoxypropan-2-amine |
| SMILES | COCC(N)COCC1C=CC=CC1 |
| InChI | InChI=1S/C11H19NO2/c1-13-8-11(12)9-14-7-10-5-3-2-4-6-10/h2-5,10-11H,6-9,12H2,1H3 |
| InChIKey | OIWGQDJCUGVEAG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(cyclohexa-2,4-dien-1-ylmethoxy)-3-methoxypropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexa-2,4-dien-1-ylmethoxy)-3-methoxypropan-2-amine?
The IUPAC name of 1-(cyclohexa-2,4-dien-1-ylmethoxy)-3-methoxypropan-2-amine (CID 89297529) is 1-(cyclohexa-2,4-dien-1-ylmethoxy)-3-methoxypropan-2-amine.
What is the SMILES notation for 1-(cyclohexa-2,4-dien-1-ylmethoxy)-3-methoxypropan-2-amine?
The canonical SMILES for 1-(cyclohexa-2,4-dien-1-ylmethoxy)-3-methoxypropan-2-amine is COCC(N)COCC1C=CC=CC1.
What is the InChIKey of 1-(cyclohexa-2,4-dien-1-ylmethoxy)-3-methoxypropan-2-amine?
The InChIKey is OIWGQDJCUGVEAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-13-8-11(12)9-14-7-10-5-3-2-4-6-10/h2-5,10-11H,6-9,12H2,1H3.
What are the key properties of 1-(cyclohexa-2,4-dien-1-ylmethoxy)-3-methoxypropan-2-amine?
1-(cyclohexa-2,4-dien-1-ylmethoxy)-3-methoxypropan-2-amine has a molecular weight of 197.28 g/mol, XLogP of 1.11, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexa-2,4-dien-1-ylmethoxy)-3-methoxypropan-2-amine is sourced from PubChem (CID 89297529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).