About 2-(4-fluoro-3-methylcyclohexa-1,3-dien-1-yl)acetic acid
2-(4-fluoro-3-methylcyclohexa-1,3-dien-1-yl)acetic acid (PubChem CID 89297544) has the molecular formula C9H11FO2
and a molecular weight of 170.18 g/mol. Its IUPAC name is 2-(4-fluoro-3-methylcyclohexa-1,3-dien-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(4-fluoro-3-methylcyclohexa-1,3-dien-1-yl)acetic acid |
| PubChem CID | 89297544 |
| Molecular Formula | C9H11FO2 |
| Molecular Weight | 170.18 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 2-(4-fluoro-3-methylcyclohexa-1,3-dien-1-yl)acetic acid |
| SMILES | CC1=C(F)CCC(CC(=O)O)=C1 |
| InChI | InChI=1S/C9H11FO2/c1-6-4-7(5-9(11)12)2-3-8(6)10/h4H,2-3,5H2,1H3,(H,11,12) |
| InChIKey | LXNJUOQSJOGXTQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.18 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-fluoro-3-methylcyclohexa-1,3-dien-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluoro-3-methylcyclohexa-1,3-dien-1-yl)acetic acid?
The IUPAC name of 2-(4-fluoro-3-methylcyclohexa-1,3-dien-1-yl)acetic acid (CID 89297544) is 2-(4-fluoro-3-methylcyclohexa-1,3-dien-1-yl)acetic acid.
What is the SMILES notation for 2-(4-fluoro-3-methylcyclohexa-1,3-dien-1-yl)acetic acid?
The canonical SMILES for 2-(4-fluoro-3-methylcyclohexa-1,3-dien-1-yl)acetic acid is CC1=C(F)CCC(CC(=O)O)=C1.
What is the InChIKey of 2-(4-fluoro-3-methylcyclohexa-1,3-dien-1-yl)acetic acid?
The InChIKey is LXNJUOQSJOGXTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FO2/c1-6-4-7(5-9(11)12)2-3-8(6)10/h4H,2-3,5H2,1H3,(H,11,12).
What are the key properties of 2-(4-fluoro-3-methylcyclohexa-1,3-dien-1-yl)acetic acid?
2-(4-fluoro-3-methylcyclohexa-1,3-dien-1-yl)acetic acid has a molecular weight of 170.18 g/mol, XLogP of 2.42, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluoro-3-methylcyclohexa-1,3-dien-1-yl)acetic acid is sourced from PubChem (CID 89297544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).