C42H48N4O4 — CID 89297713
1-N,4-N-bis(phenylmethoxy)cyclohexane-1,4-diimine;5,5-dimethyl-1-N,3-N-bis(phenylmethoxy)cyclohexane-1,3-diimine (PubChem CID 89297713) has the molecular formula C42H48N4O4 and a molecular weight of 672.87 g/mol. Its IUPAC name is 1-N,4-N-bis(phenylmethoxy)cyclohexane-1,4-diimine;5,5-dimethyl-1-N,3-N-bis(phenylmethoxy)cyclohexane-1,3-diimine.
| Compound Name | 1-N,4-N-bis(phenylmethoxy)cyclohexane-1,4-diimine;5,5-dimethyl-1-N,3-N-bis(phenylmethoxy)cyclohexane-1,3-diimine |
|---|---|
| PubChem CID | 89297713 |
| Molecular Formula | C42H48N4O4 |
| Molecular Weight | 672.87 g/mol |
| Exact Mass | 672.37 |
| IUPAC Name | 1-N,4-N-bis(phenylmethoxy)cyclohexane-1,4-diimine;5,5-dimethyl-1-N,3-N-bis(phenylmethoxy)cyclohexane-1,3-diimine |
| SMILES | CC1(C)C/C(=N/OCc2ccccc2)C/C(=N/OCc2ccccc2)C1.c1ccc(CON=C2CCC(=NOCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H26N2O2.C20H22N2O2/c1-22(2)14-20(23-25-16-18-9-5-3-6-10-18)13-21(15-22)24-26-17-19-11-7-4-8-12-19;1-3-7-17(8-4-1)15-23-21-19-11-13-20(14-12-19)22-24-16-18-9-5-2-6-10-18/h3-12H,13-17H2,1-2H3;1-10H,11-16H2/b23-20-,24-21+;21-19-,22-20+ |
| InChIKey | PGASYAMGDWEBII-HMBQEPLTSA-N |
| XLogP | 10.05 |
| TPSA | 86.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.87 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|