C31H36N6O5 — CID 89297837
(2E,4Z)-5-amino-3-[[3-(2,4-dimethylphenoxy)-2-hydroxypropyl]amino]-2-[6-(1-methylpiperidin-3-yl)-5,7-dioxo-3H-pyrrolo[3,4-f]benzimidazol-2-yl]penta-2,4-dienal (PubChem CID 89297837) has the molecular formula C31H36N6O5 and a molecular weight of 572.67 g/mol. Its IUPAC name is (2E,4Z)-5-amino-3-[[3-(2,4-dimethylphenoxy)-2-hydroxypropyl]amino]-2-[6-(1-methylpiperidin-3-yl)-5,7-dioxo-3H-pyrrolo[3,4-f]benzimidazol-2-yl]penta-2,4-dienal.
| Compound Name | (2E,4Z)-5-amino-3-[[3-(2,4-dimethylphenoxy)-2-hydroxypropyl]amino]-2-[6-(1-methylpiperidin-3-yl)-5,7-dioxo-3H-pyrrolo[3,4-f]benzimidazol-2-yl]penta-2,4-dienal |
|---|---|
| PubChem CID | 89297837 |
| Molecular Formula | C31H36N6O5 |
| Molecular Weight | 572.67 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | (2E,4Z)-5-amino-3-[[3-(2,4-dimethylphenoxy)-2-hydroxypropyl]amino]-2-[6-(1-methylpiperidin-3-yl)-5,7-dioxo-3H-pyrrolo[3,4-f]benzimidazol-2-yl]penta-2,4-dienal |
| SMILES | Cc1ccc(OCC(O)CNC(/C=C\N)=C(/C=O)c2nc3cc4c(cc3[nH]2)C(=O)N(C2CCCN(C)C2)C4=O)c(C)c1 |
| InChI | InChI=1S/C31H36N6O5/c1-18-6-7-28(19(2)11-18)42-17-21(39)14-33-25(8-9-32)24(16-38)29-34-26-12-22-23(13-27(26)35-29)31(41)37(30(22)40)20-5-4-10-36(3)15-20/h6-9,11-13,16,20-21,33,39H,4-5,10,14-15,17,32H2,1-3H3,(H,34,35)/b9-8-,25-24- |
| InChIKey | CFFUNUXWWVXIBP-MAIUAXFNSA-N |
| XLogP | 2.28 |
| TPSA | 153.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.67 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|