About 2-[(4S)-4,5-difluorocyclohexa-1,5-dien-1-yl]cyclopropan-1-amine
2-[(4S)-4,5-difluorocyclohexa-1,5-dien-1-yl]cyclopropan-1-amine (PubChem CID 89298069) has the molecular formula C9H11F2N
and a molecular weight of 171.19 g/mol. Its IUPAC name is 2-[(4S)-4,5-difluorocyclohexa-1,5-dien-1-yl]cyclopropan-1-amine.
Molecular Properties
| Compound Name | 2-[(4S)-4,5-difluorocyclohexa-1,5-dien-1-yl]cyclopropan-1-amine |
| PubChem CID | 89298069 |
| Molecular Formula | C9H11F2N |
| Molecular Weight | 171.19 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 2-[(4S)-4,5-difluorocyclohexa-1,5-dien-1-yl]cyclopropan-1-amine |
| SMILES | NC1CC1C1=CC[C@H](F)C(F)=C1 |
| InChI | InChI=1S/C9H11F2N/c10-7-2-1-5(3-8(7)11)6-4-9(6)12/h1,3,6-7,9H,2,4,12H2/t6?,7-,9?/m0/s1 |
| InChIKey | WCOWTMPIBGQGRQ-CRMOQAEOSA-N |
| XLogP | 1.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(4S)-4,5-difluorocyclohexa-1,5-dien-1-yl]cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4S)-4,5-difluorocyclohexa-1,5-dien-1-yl]cyclopropan-1-amine?
The IUPAC name of 2-[(4S)-4,5-difluorocyclohexa-1,5-dien-1-yl]cyclopropan-1-amine (CID 89298069) is 2-[(4S)-4,5-difluorocyclohexa-1,5-dien-1-yl]cyclopropan-1-amine.
What is the SMILES notation for 2-[(4S)-4,5-difluorocyclohexa-1,5-dien-1-yl]cyclopropan-1-amine?
The canonical SMILES for 2-[(4S)-4,5-difluorocyclohexa-1,5-dien-1-yl]cyclopropan-1-amine is NC1CC1C1=CC[C@H](F)C(F)=C1.
What is the InChIKey of 2-[(4S)-4,5-difluorocyclohexa-1,5-dien-1-yl]cyclopropan-1-amine?
The InChIKey is WCOWTMPIBGQGRQ-CRMOQAEOSA-N. The full InChI is InChI=1S/C9H11F2N/c10-7-2-1-5(3-8(7)11)6-4-9(6)12/h1,3,6-7,9H,2,4,12H2/t6?,7-,9?/m0/s1.
What are the key properties of 2-[(4S)-4,5-difluorocyclohexa-1,5-dien-1-yl]cyclopropan-1-amine?
2-[(4S)-4,5-difluorocyclohexa-1,5-dien-1-yl]cyclopropan-1-amine has a molecular weight of 171.19 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4S)-4,5-difluorocyclohexa-1,5-dien-1-yl]cyclopropan-1-amine is sourced from PubChem (CID 89298069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).