C21H24FN — CID 89298077
(2Z)-N-(cyclopropylmethyl)-2-[(5E,7E)-8-fluoro-3-methylidenedeca-1,5,7,9-tetraen-4-ylidene]cyclohex-3-en-1-imine (PubChem CID 89298077) has the molecular formula C21H24FN and a molecular weight of 309.43 g/mol. Its IUPAC name is (2Z)-N-(cyclopropylmethyl)-2-[(5E,7E)-8-fluoro-3-methylidenedeca-1,5,7,9-tetraen-4-ylidene]cyclohex-3-en-1-imine.
| Compound Name | (2Z)-N-(cyclopropylmethyl)-2-[(5E,7E)-8-fluoro-3-methylidenedeca-1,5,7,9-tetraen-4-ylidene]cyclohex-3-en-1-imine |
|---|---|
| PubChem CID | 89298077 |
| Molecular Formula | C21H24FN |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | (2Z)-N-(cyclopropylmethyl)-2-[(5E,7E)-8-fluoro-3-methylidenedeca-1,5,7,9-tetraen-4-ylidene]cyclohex-3-en-1-imine |
| SMILES | C=CC(=C)C(/C=C/C=C(/F)C=C)=C1/C=CCC/C1=N\CC1CC1 |
| InChI | InChI=1S/C21H24FN/c1-4-16(3)19(11-8-9-18(22)5-2)20-10-6-7-12-21(20)23-15-17-13-14-17/h4-6,8-11,17H,1-3,7,12-15H2/b11-8+,18-9+,20-19-,23-21+ |
| InChIKey | OLJFEALJDYFRRY-CQHYWFPESA-N |
| XLogP | 5.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|