C31H35BN6 — CID 89298180
CID 89298180 (PubChem CID 89298180) has the molecular formula C31H35BN6 and a molecular weight of 502.48 g/mol.
| Compound Name | CID 89298180 |
|---|---|
| PubChem CID | 89298180 |
| Molecular Formula | C31H35BN6 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCc3cccnc3)cc(C3CCN(C(=C)C(c4ccccc4)C4CCCC4)CC3)nc12 |
| InChI | InChI=1S/C31H35BN6/c1-22(30(26-11-5-6-12-26)25-9-3-2-4-10-25)37-16-13-24(14-17-37)28-18-29(34-20-23-8-7-15-33-19-23)38-31(36-28)27(32)21-35-38/h2-4,7-10,15,18-19,21,24,26,30,34H,1,5-6,11-14,16-17,20H2 |
| InChIKey | QUBLSPDBSQPPHV-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|