About (2R)-oxirane-2-carbonyl chloride
(2R)-oxirane-2-carbonyl chloride (PubChem CID 89298336) has the molecular formula C3H3ClO2
and a molecular weight of 106.51 g/mol. Its IUPAC name is (2R)-oxirane-2-carbonyl chloride.
Molecular Properties
| Compound Name | (2R)-oxirane-2-carbonyl chloride |
| PubChem CID | 89298336 |
| Molecular Formula | C3H3ClO2 |
| Molecular Weight | 106.51 g/mol |
| Exact Mass | 105.98 |
| IUPAC Name | (2R)-oxirane-2-carbonyl chloride |
| SMILES | O=C(Cl)[C@H]1CO1 |
| InChI | InChI=1S/C3H3ClO2/c4-3(5)2-1-6-2/h2H,1H2/t2-/m1/s1 |
| InChIKey | BUYGWVWSUADNOS-UWTATZPHSA-N |
| XLogP | 0.15 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.51 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R)-oxirane-2-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-oxirane-2-carbonyl chloride?
The IUPAC name of (2R)-oxirane-2-carbonyl chloride (CID 89298336) is (2R)-oxirane-2-carbonyl chloride.
What is the SMILES notation for (2R)-oxirane-2-carbonyl chloride?
The canonical SMILES for (2R)-oxirane-2-carbonyl chloride is O=C(Cl)[C@H]1CO1.
What is the InChIKey of (2R)-oxirane-2-carbonyl chloride?
The InChIKey is BUYGWVWSUADNOS-UWTATZPHSA-N. The full InChI is InChI=1S/C3H3ClO2/c4-3(5)2-1-6-2/h2H,1H2/t2-/m1/s1.
What are the key properties of (2R)-oxirane-2-carbonyl chloride?
(2R)-oxirane-2-carbonyl chloride has a molecular weight of 106.51 g/mol, XLogP of 0.15, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-oxirane-2-carbonyl chloride is sourced from PubChem (CID 89298336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).