C24H32F3NO3S — CID 89298397
(E,3S,6R)-7-[(Z)-2-amino-4-hydroxy-3-methyl-4-[4-(trifluoromethyl)phenyl]but-3-enyl]sulfanyl-4-ethenyl-3,6-dimethyloct-4-enoic acid (PubChem CID 89298397) has the molecular formula C24H32F3NO3S and a molecular weight of 471.59 g/mol. Its IUPAC name is (E,3S,6R)-7-[(Z)-2-amino-4-hydroxy-3-methyl-4-[4-(trifluoromethyl)phenyl]but-3-enyl]sulfanyl-4-ethenyl-3,6-dimethyloct-4-enoic acid.
| Compound Name | (E,3S,6R)-7-[(Z)-2-amino-4-hydroxy-3-methyl-4-[4-(trifluoromethyl)phenyl]but-3-enyl]sulfanyl-4-ethenyl-3,6-dimethyloct-4-enoic acid |
|---|---|
| PubChem CID | 89298397 |
| Molecular Formula | C24H32F3NO3S |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | (E,3S,6R)-7-[(Z)-2-amino-4-hydroxy-3-methyl-4-[4-(trifluoromethyl)phenyl]but-3-enyl]sulfanyl-4-ethenyl-3,6-dimethyloct-4-enoic acid |
| SMILES | C=C/C(=C\[C@@H](C)C(C)SCC(N)/C(C)=C(\O)c1ccc(C(F)(F)F)cc1)[C@@H](C)CC(=O)O |
| InChI | InChI=1S/C24H32F3NO3S/c1-6-18(15(3)12-22(29)30)11-14(2)17(5)32-13-21(28)16(4)23(31)19-7-9-20(10-8-19)24(25,26)27/h6-11,14-15,17,21,31H,1,12-13,28H2,2-5H3,(H,29,30)/b18-11+,23-16-/t14-,15+,17?,21?/m1/s1 |
| InChIKey | IDIKYHRYOUMIFQ-ODPNTABGSA-N |
| XLogP | 6.30 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|