C12H8F7NO2 — CID 89298413
5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenyl-4H-1,2-oxazol-5-ol (PubChem CID 89298413) has the molecular formula C12H8F7NO2 and a molecular weight of 331.19 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenyl-4H-1,2-oxazol-5-ol.
| Compound Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenyl-4H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 89298413 |
| Molecular Formula | C12H8F7NO2 |
| Molecular Weight | 331.19 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenyl-4H-1,2-oxazol-5-ol |
| SMILES | OC1(C(F)(F)C(F)(F)C(F)(F)F)CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C12H8F7NO2/c13-10(14,11(15,16)12(17,18)19)9(21)6-8(20-22-9)7-4-2-1-3-5-7/h1-5,21H,6H2 |
| InChIKey | SXKOHIRLQSVPHI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.19 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|