C10H15N — CID 89298457
4-[(1Z)-buta-1,3-dienyl]-5-methyl-1,2,3,6-tetrahydropyridine (PubChem CID 89298457) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-5-methyl-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-5-methyl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 89298457 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-5-methyl-1,2,3,6-tetrahydropyridine |
| SMILES | C=C/C=C\C1=C(C)CNCC1 |
| InChI | InChI=1S/C10H15N/c1-3-4-5-10-6-7-11-8-9(10)2/h3-5,11H,1,6-8H2,2H3/b5-4- |
| InChIKey | SPNZIHUFFFXPSO-PLNGDYQASA-N |
| XLogP | 2.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|