C16H21NO2 — CID 89298501
5-[[2-[(1E,3Z)-2-hydroxypenta-1,3-dienyl]cyclobutyl]amino]cyclohepta-1,3,6-trien-1-ol (PubChem CID 89298501) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 5-[[2-[(1E,3Z)-2-hydroxypenta-1,3-dienyl]cyclobutyl]amino]cyclohepta-1,3,6-trien-1-ol.
| Compound Name | 5-[[2-[(1E,3Z)-2-hydroxypenta-1,3-dienyl]cyclobutyl]amino]cyclohepta-1,3,6-trien-1-ol |
|---|---|
| PubChem CID | 89298501 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 5-[[2-[(1E,3Z)-2-hydroxypenta-1,3-dienyl]cyclobutyl]amino]cyclohepta-1,3,6-trien-1-ol |
| SMILES | C/C=C\C(O)=C/C1CCC1NC1C=CC=C(O)C=C1 |
| InChI | InChI=1S/C16H21NO2/c1-2-4-15(19)11-12-7-10-16(12)17-13-5-3-6-14(18)9-8-13/h2-6,8-9,11-13,16-19H,7,10H2,1H3/b4-2-,15-11+ |
| InChIKey | AHCBUQHDVVXRJY-VQNQEHLPSA-N |
| XLogP | 3.31 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|