C17H29N — CID 89298597
5,5,7-trimethyl-6-[(1Z,3E)-4-methylhepta-1,3-dienyl]-1,2,3,4-tetrahydroazepine (PubChem CID 89298597) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is 5,5,7-trimethyl-6-[(1Z,3E)-4-methylhepta-1,3-dienyl]-1,2,3,4-tetrahydroazepine.
| Compound Name | 5,5,7-trimethyl-6-[(1Z,3E)-4-methylhepta-1,3-dienyl]-1,2,3,4-tetrahydroazepine |
|---|---|
| PubChem CID | 89298597 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 5,5,7-trimethyl-6-[(1Z,3E)-4-methylhepta-1,3-dienyl]-1,2,3,4-tetrahydroazepine |
| SMILES | CCC/C(C)=C/C=C\C1=C(C)NCCCC1(C)C |
| InChI | InChI=1S/C17H29N/c1-6-9-14(2)10-7-11-16-15(3)18-13-8-12-17(16,4)5/h7,10-11,18H,6,8-9,12-13H2,1-5H3/b11-7-,14-10+ |
| InChIKey | GEEIXGNDKMEDJU-KXCISIKOSA-N |
| XLogP | 4.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|