C36H56O5 — CID 89298658
1-adamantylmethoxymethyl 10-(2-tert-butyl-4,4-dimethylpentanoyl)oxytetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 89298658) has the molecular formula C36H56O5 and a molecular weight of 568.84 g/mol. Its IUPAC name is 1-adamantylmethoxymethyl 10-(2-tert-butyl-4,4-dimethylpentanoyl)oxytetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | 1-adamantylmethoxymethyl 10-(2-tert-butyl-4,4-dimethylpentanoyl)oxytetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 89298658 |
| Molecular Formula | C36H56O5 |
| Molecular Weight | 568.84 g/mol |
| Exact Mass | 568.41 |
| IUPAC Name | 1-adamantylmethoxymethyl 10-(2-tert-butyl-4,4-dimethylpentanoyl)oxytetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CC(C)(C)CC(C(=O)OC1CC2CC1C1C3CC(CC3C(=O)OCOCC34CC5CC(CC(C5)C3)C4)C21)C(C)(C)C |
| InChI | InChI=1S/C36H56O5/c1-34(2,3)17-28(35(4,5)6)33(38)41-29-13-24-12-27(29)31-25-10-23(30(24)31)11-26(25)32(37)40-19-39-18-36-14-20-7-21(15-36)9-22(8-20)16-36/h20-31H,7-19H2,1-6H3 |
| InChIKey | OHQBXJRNEVYJMP-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.84 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|