C48H46N2 — CID 89298713
N-[4-[4-(4-cyclohexa-2,4-dien-1-ylanilino)cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-dien-1-yl]-N-(5,6-dihydronaphthalen-1-yl)-3,4,5,6-tetrahydrophenanthren-9-amine (PubChem CID 89298713) has the molecular formula C48H46N2 and a molecular weight of 650.91 g/mol. Its IUPAC name is N-[4-[4-(4-cyclohexa-2,4-dien-1-ylanilino)cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-dien-1-yl]-N-(5,6-dihydronaphthalen-1-yl)-3,4,5,6-tetrahydrophenanthren-9-amine.
| Compound Name | N-[4-[4-(4-cyclohexa-2,4-dien-1-ylanilino)cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-dien-1-yl]-N-(5,6-dihydronaphthalen-1-yl)-3,4,5,6-tetrahydrophenanthren-9-amine |
|---|---|
| PubChem CID | 89298713 |
| Molecular Formula | C48H46N2 |
| Molecular Weight | 650.91 g/mol |
| Exact Mass | 650.37 |
| IUPAC Name | N-[4-[4-(4-cyclohexa-2,4-dien-1-ylanilino)cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-dien-1-yl]-N-(5,6-dihydronaphthalen-1-yl)-3,4,5,6-tetrahydrophenanthren-9-amine |
| SMILES | C1=CCC(c2ccc(NC3=CC=C(C4=CC=C(N(c5cccc6c5C=CCC6)c5cc6c(c7c5C=CCC7)CCC=C6)CC4)CC3)cc2)C=C1 |
| InChI | InChI=1S/C48H46N2/c1-2-11-34(12-3-1)35-21-27-40(28-22-35)49-41-29-23-36(24-30-41)37-25-31-42(32-26-37)50(47-20-10-15-38-13-4-7-17-44(38)47)48-33-39-14-5-6-16-43(39)45-18-8-9-19-46(45)48/h1-3,5,7,9-11,14-15,17,19-23,25,27-29,31,33-34,49H,4,6,8,12-13,16,18,24,26,30,32H2 |
| InChIKey | CWRMOHQKEDPSHS-UHFFFAOYSA-N |
| XLogP | 12.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.91 |
| LogP ≤ 5 | 12.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |