C17H23NO2 — CID 89298764
5-[[2-[(1E,3Z)-2-hydroxypenta-1,3-dienyl]cyclobutyl]amino]-2-methylcyclohepta-1,3,6-trien-1-ol (PubChem CID 89298764) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 5-[[2-[(1E,3Z)-2-hydroxypenta-1,3-dienyl]cyclobutyl]amino]-2-methylcyclohepta-1,3,6-trien-1-ol.
| Compound Name | 5-[[2-[(1E,3Z)-2-hydroxypenta-1,3-dienyl]cyclobutyl]amino]-2-methylcyclohepta-1,3,6-trien-1-ol |
|---|---|
| PubChem CID | 89298764 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 5-[[2-[(1E,3Z)-2-hydroxypenta-1,3-dienyl]cyclobutyl]amino]-2-methylcyclohepta-1,3,6-trien-1-ol |
| SMILES | C/C=C\C(O)=C/C1CCC1NC1C=CC(C)=C(O)C=C1 |
| InChI | InChI=1S/C17H23NO2/c1-3-4-15(19)11-13-6-9-16(13)18-14-7-5-12(2)17(20)10-8-14/h3-5,7-8,10-11,13-14,16,18-20H,6,9H2,1-2H3/b4-3-,15-11+ |
| InChIKey | VSZSWVXKCNVTBO-ZADSNCOHSA-N |
| XLogP | 3.70 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|