C27H28BrN5O4S — CID 89298776
[(2R)-2-[[(E)-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoyl]amino]-2-phenylethyl] 5-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate (PubChem CID 89298776) has the molecular formula C27H28BrN5O4S and a molecular weight of 598.52 g/mol. Its IUPAC name is [(2R)-2-[[(E)-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoyl]amino]-2-phenylethyl] 5-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate.
| Compound Name | [(2R)-2-[[(E)-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoyl]amino]-2-phenylethyl] 5-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
|---|---|
| PubChem CID | 89298776 |
| Molecular Formula | C27H28BrN5O4S |
| Molecular Weight | 598.52 g/mol |
| Exact Mass | 597.10 |
| IUPAC Name | [(2R)-2-[[(E)-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoyl]amino]-2-phenylethyl] 5-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
| SMILES | N#C/C(=C\c1cccc(Br)n1)C(=O)N[C@@H](COC(=O)CCCC[C@H]1SCC2NC(=O)NC21)c1ccccc1 |
| InChI | InChI=1S/C27H28BrN5O4S/c28-23-11-6-9-19(30-23)13-18(14-29)26(35)31-20(17-7-2-1-3-8-17)15-37-24(34)12-5-4-10-22-25-21(16-38-22)32-27(36)33-25/h1-3,6-9,11,13,20-22,25H,4-5,10,12,15-16H2,(H,31,35)(H2,32,33,36)/b18-13+/t20-,21?,22+,25?/m0/s1 |
| InChIKey | GANHGYIYJKEAGC-QHAPVTDJSA-N |
| XLogP | 3.88 |
| TPSA | 133.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|