C11H18N2O — CID 89298879
(3E,6E)-3-ethenyl-8-methyl-4-(methylamino)-1,2,5,8-tetrahydroazocin-2-ol (PubChem CID 89298879) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is (3E,6E)-3-ethenyl-8-methyl-4-(methylamino)-1,2,5,8-tetrahydroazocin-2-ol.
| Compound Name | (3E,6E)-3-ethenyl-8-methyl-4-(methylamino)-1,2,5,8-tetrahydroazocin-2-ol |
|---|---|
| PubChem CID | 89298879 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (3E,6E)-3-ethenyl-8-methyl-4-(methylamino)-1,2,5,8-tetrahydroazocin-2-ol |
| SMILES | C=C/C1=C(\NC)C/C=C\C(C)NC1O |
| InChI | InChI=1S/C11H18N2O/c1-4-9-10(12-3)7-5-6-8(2)13-11(9)14/h4-6,8,11-14H,1,7H2,2-3H3/b6-5-,10-9+ |
| InChIKey | JDHWYHXLODINNN-MLCWLASSSA-N |
| XLogP | 0.90 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|