About 4-ethenylcyclohexa-2,4-dien-1-ol
4-ethenylcyclohexa-2,4-dien-1-ol (PubChem CID 89298961) has the molecular formula C8H10O
and a molecular weight of 122.17 g/mol. Its IUPAC name is 4-ethenylcyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 4-ethenylcyclohexa-2,4-dien-1-ol |
| PubChem CID | 89298961 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 4-ethenylcyclohexa-2,4-dien-1-ol |
| SMILES | C=CC1=CCC(O)C=C1 |
| InChI | InChI=1S/C8H10O/c1-2-7-3-5-8(9)6-4-7/h2-5,8-9H,1,6H2 |
| InChIKey | OJCJXAFEYLJNRF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethenylcyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenylcyclohexa-2,4-dien-1-ol?
The IUPAC name of 4-ethenylcyclohexa-2,4-dien-1-ol (CID 89298961) is 4-ethenylcyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 4-ethenylcyclohexa-2,4-dien-1-ol?
The canonical SMILES for 4-ethenylcyclohexa-2,4-dien-1-ol is C=CC1=CCC(O)C=C1.
What is the InChIKey of 4-ethenylcyclohexa-2,4-dien-1-ol?
The InChIKey is OJCJXAFEYLJNRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O/c1-2-7-3-5-8(9)6-4-7/h2-5,8-9H,1,6H2.
What are the key properties of 4-ethenylcyclohexa-2,4-dien-1-ol?
4-ethenylcyclohexa-2,4-dien-1-ol has a molecular weight of 122.17 g/mol, XLogP of 1.42, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenylcyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 89298961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).